C21H25ClN4OS — CID 46269623
N-(4-chlorophenyl)-2-[2-(3,5-dimethyl-4-pentylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 46269623) has the molecular formula C21H25ClN4OS and a molecular weight of 416.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-(3,5-dimethyl-4-pentylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-(3,5-dimethyl-4-pentylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46269623 |
| Molecular Formula | C21H25ClN4OS |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-(3,5-dimethyl-4-pentylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCCCCc1c(C)nn(-c2nc(CC(=O)Nc3ccc(Cl)cc3)cs2)c1C |
| InChI | InChI=1S/C21H25ClN4OS/c1-4-5-6-7-19-14(2)25-26(15(19)3)21-24-18(13-28-21)12-20(27)23-17-10-8-16(22)9-11-17/h8-11,13H,4-7,12H2,1-3H3,(H,23,27) |
| InChIKey | VEBHHYHQTICOFD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|