C22H25N3O4 — CID 46267238
N-butyl-2-[2-methoxy-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide (PubChem CID 46267238) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-butyl-2-[2-methoxy-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide.
| Compound Name | N-butyl-2-[2-methoxy-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 46267238 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-butyl-2-[2-methoxy-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide |
| SMILES | CCCCNC(=O)COc1ccc(-c2noc(-c3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C22H25N3O4/c1-4-5-12-23-20(26)14-28-18-11-10-17(13-19(18)27-3)21-24-22(29-25-21)16-8-6-15(2)7-9-16/h6-11,13H,4-5,12,14H2,1-3H3,(H,23,26) |
| InChIKey | LZXZQSQOAZISOA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|