C23H29N5O2 — CID 46273952
8-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (PubChem CID 46273952) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 8-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one.
| Compound Name | 8-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 46273952 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 8-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| SMILES | O=C(CCn1c(=O)c2cccn2c2cccnc21)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c29-21(26-16-14-25(15-17-26)18-6-2-1-3-7-18)10-13-28-22-19(8-4-11-24-22)27-12-5-9-20(27)23(28)30/h4-5,8-9,11-12,18H,1-3,6-7,10,13-17H2 |
| InChIKey | WDSIILJDVLAPKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |