C20H20N2O3S — CID 46281870
5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-3-propan-2-ylidene-1H-indol-2-one (PubChem CID 46281870) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-3-propan-2-ylidene-1H-indol-2-one.
| Compound Name | 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-3-propan-2-ylidene-1H-indol-2-one |
|---|---|
| PubChem CID | 46281870 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-3-propan-2-ylidene-1H-indol-2-one |
| SMILES | CC(C)=C1C(=O)Nc2ccc(S(=O)(=O)N3CCc4ccccc4C3)cc21 |
| InChI | InChI=1S/C20H20N2O3S/c1-13(2)19-17-11-16(7-8-18(17)21-20(19)23)26(24,25)22-10-9-14-5-3-4-6-15(14)12-22/h3-8,11H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | NGLATMLLSLSGJK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|