C24H27ClN4O3S — CID 46283466
4-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]quinolin-6-yl]sulfonylmorpholine (PubChem CID 46283466) has the molecular formula C24H27ClN4O3S and a molecular weight of 487.03 g/mol. Its IUPAC name is 4-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]quinolin-6-yl]sulfonylmorpholine.
| Compound Name | 4-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]quinolin-6-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 46283466 |
| Molecular Formula | C24H27ClN4O3S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]quinolin-6-yl]sulfonylmorpholine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(c2ccc3cc(S(=O)(=O)N4CCOCC4)ccc3n2)CC1 |
| InChI | InChI=1S/C24H27ClN4O3S/c1-18-2-4-20(25)17-23(18)27-8-10-28(11-9-27)24-7-3-19-16-21(5-6-22(19)26-24)33(30,31)29-12-14-32-15-13-29/h2-7,16-17H,8-15H2,1H3 |
| InChIKey | UPTFSHSEXKSATB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |