C19H21N3O4S2 — CID 46287509
4-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 46287509) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46287509 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2sc(=S)n(Cc3ccco3)c2N)cc1OC |
| InChI | InChI=1S/C19H21N3O4S2/c1-24-14-6-5-12(10-15(14)25-2)7-8-21-18(23)16-17(20)22(19(27)28-16)11-13-4-3-9-26-13/h3-6,9-10H,7-8,11,20H2,1-2H3,(H,21,23) |
| InChIKey | QJTSHLWBKPVQJG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|