About 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone
1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 46290443) has the molecular formula C22H19ClN4O
and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone |
| PubChem CID | 46290443 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ncnc3c2c(C)c(C)n3-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19ClN4O/c1-13-14(2)27(19-6-4-5-17(23)11-19)22-20(13)21(24-12-25-22)26-18-9-7-16(8-10-18)15(3)28/h4-12H,1-3H3,(H,24,25,26) |
| InChIKey | FSZRDJGDESBIRP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone?
The IUPAC name of 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone (CID 46290443) is 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone.
What is the SMILES notation for 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone?
The canonical SMILES for 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone is CC(=O)c1ccc(Nc2ncnc3c2c(C)c(C)n3-c2cccc(Cl)c2)cc1.
What is the InChIKey of 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone?
The InChIKey is FSZRDJGDESBIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN4O/c1-13-14(2)27(19-6-4-5-17(23)11-19)22-20(13)21(24-12-25-22)26-18-9-7-16(8-10-18)15(3)28/h4-12H,1-3H3,(H,24,25,26).
What are the key properties of 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone?
1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone has a molecular weight of 390.87 g/mol, XLogP of 5.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]ethanone is sourced from PubChem (CID 46290443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).