C22H20F3N3O2S — CID 46292824
4-[2-(1-benzothiophen-3-yl)acetyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 46292824) has the molecular formula C22H20F3N3O2S and a molecular weight of 447.48 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-3-yl)acetyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(1-benzothiophen-3-yl)acetyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46292824 |
| Molecular Formula | C22H20F3N3O2S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-[2-(1-benzothiophen-3-yl)acetyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Cc1csc2ccccc12)N1CCN(C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H20F3N3O2S/c23-22(24,25)16-4-3-5-17(13-16)26-21(30)28-10-8-27(9-11-28)20(29)12-15-14-31-19-7-2-1-6-18(15)19/h1-7,13-14H,8-12H2,(H,26,30) |
| InChIKey | GTYHTDMNDJOYDO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |