C23H25Cl2N5O — CID 46293871
2-chloro-N-[N-(3-chloro-2-methylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide (PubChem CID 46293871) has the molecular formula C23H25Cl2N5O and a molecular weight of 458.39 g/mol. Its IUPAC name is 2-chloro-N-[N-(3-chloro-2-methylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 2-chloro-N-[N-(3-chloro-2-methylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293871 |
| Molecular Formula | C23H25Cl2N5O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-chloro-N-[N-(3-chloro-2-methylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
| SMILES | CCCn1cc(C/N=C(\NC(=O)c2ccccc2Cl)Nc2cccc(Cl)c2C)c(C)n1 |
| InChI | InChI=1S/C23H25Cl2N5O/c1-4-12-30-14-17(16(3)29-30)13-26-23(27-21-11-7-10-19(24)15(21)2)28-22(31)18-8-5-6-9-20(18)25/h5-11,14H,4,12-13H2,1-3H3,(H2,26,27,28,31) |
| InChIKey | WSBOCUZWQGSDBH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|