C28H37N5O2 — CID 46293793
4-tert-butyl-N-[N-(2-ethoxyphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide (PubChem CID 46293793) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[N-(2-ethoxyphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 4-tert-butyl-N-[N-(2-ethoxyphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293793 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 4-tert-butyl-N-[N-(2-ethoxyphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
| SMILES | CCCn1cc(C/N=C(\NC(=O)c2ccc(C(C)(C)C)cc2)Nc2ccccc2OCC)c(C)n1 |
| InChI | InChI=1S/C28H37N5O2/c1-7-17-33-19-22(20(3)32-33)18-29-27(30-24-11-9-10-12-25(24)35-8-2)31-26(34)21-13-15-23(16-14-21)28(4,5)6/h9-16,19H,7-8,17-18H2,1-6H3,(H2,29,30,31,34) |
| InChIKey | WJOFZQSJALKJRW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|