C22H14F3NO3S — CID 46296960
[1,1-dioxo-4-[3-(trifluoromethyl)phenyl]-1λ6,4-benzothiazin-2-yl]-phenylmethanone (PubChem CID 46296960) has the molecular formula C22H14F3NO3S and a molecular weight of 429.42 g/mol. Its IUPAC name is [1,1-dioxo-4-[3-(trifluoromethyl)phenyl]-1λ6,4-benzothiazin-2-yl]-phenylmethanone.
| Compound Name | [1,1-dioxo-4-[3-(trifluoromethyl)phenyl]-1λ6,4-benzothiazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46296960 |
| Molecular Formula | C22H14F3NO3S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | [1,1-dioxo-4-[3-(trifluoromethyl)phenyl]-1λ6,4-benzothiazin-2-yl]-phenylmethanone |
| SMILES | O=C(C1=CN(c2cccc(C(F)(F)F)c2)c2ccccc2S1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C22H14F3NO3S/c23-22(24,25)16-9-6-10-17(13-16)26-14-20(21(27)15-7-2-1-3-8-15)30(28,29)19-12-5-4-11-18(19)26/h1-14H |
| InChIKey | MIYZWLIMIQPWSU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|