C30H24N4O3S — CID 46300005
N-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 46300005) has the molecular formula C30H24N4O3S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46300005 |
| Molecular Formula | C30H24N4O3S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1sc(NC(=O)c2cc(-c3ccc4c(c3)CCCC4)on2)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N4O3S/c35-27(21-12-5-2-6-13-21)32-29-26(20-10-3-1-4-11-20)31-30(38-29)33-28(36)24-18-25(37-34-24)23-16-15-19-9-7-8-14-22(19)17-23/h1-6,10-13,15-18H,7-9,14H2,(H,32,35)(H,31,33,36) |
| InChIKey | WEQIDZVHLQPQMC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |