C19H15Cl2N3OS — CID 46304958
N-(3,4-dichlorophenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide (PubChem CID 46304958) has the molecular formula C19H15Cl2N3OS and a molecular weight of 404.32 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 46304958 |
| Molecular Formula | C19H15Cl2N3OS |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide |
| SMILES | O=C(CCSc1cc(-c2ccccc2)ncn1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2N3OS/c20-15-7-6-14(10-16(15)21)24-18(25)8-9-26-19-11-17(22-12-23-19)13-4-2-1-3-5-13/h1-7,10-12H,8-9H2,(H,24,25) |
| InChIKey | KXIVGCSGOPAWBA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |