C23H24N4O3S2 — CID 46304971
3-(6-phenylpyrimidin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 46304971) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-(6-phenylpyrimidin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-(6-phenylpyrimidin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 46304971 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-(6-phenylpyrimidin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCSc1cc(-c2ccccc2)ncn1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H24N4O3S2/c28-22(12-15-31-23-16-21(24-17-25-23)18-6-2-1-3-7-18)26-19-8-10-20(11-9-19)32(29,30)27-13-4-5-14-27/h1-3,6-11,16-17H,4-5,12-15H2,(H,26,28) |
| InChIKey | LRGHAWLYKBTFJT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |