C21H19N3O2S — CID 46304963
N-(3-acetylphenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide (PubChem CID 46304963) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide.
| Compound Name | N-(3-acetylphenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 46304963 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(3-acetylphenyl)-3-(6-phenylpyrimidin-4-yl)sulfanylpropanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CCSc2cc(-c3ccccc3)ncn2)c1 |
| InChI | InChI=1S/C21H19N3O2S/c1-15(25)17-8-5-9-18(12-17)24-20(26)10-11-27-21-13-19(22-14-23-21)16-6-3-2-4-7-16/h2-9,12-14H,10-11H2,1H3,(H,24,26) |
| InChIKey | FKEWMVRKWCQBBB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |