C24H29N5O3S2 — CID 46305771
ethyl 2-[2-[3-amino-5-(2-phenylethylsulfanyl)-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 46305771) has the molecular formula C24H29N5O3S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is ethyl 2-[2-[3-amino-5-(2-phenylethylsulfanyl)-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-amino-5-(2-phenylethylsulfanyl)-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 46305771 |
| Molecular Formula | C24H29N5O3S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | ethyl 2-[2-[3-amino-5-(2-phenylethylsulfanyl)-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)n2c(N)nnc2SCCc2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H29N5O3S2/c1-3-32-22(31)19-17-11-7-8-12-18(17)34-21(19)26-20(30)15(2)29-23(25)27-28-24(29)33-14-13-16-9-5-4-6-10-16/h4-6,9-10,15H,3,7-8,11-14H2,1-2H3,(H2,25,27)(H,26,30) |
| InChIKey | AVIWGNMILLPDCO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |