C21H23ClN6O2S2 — CID 46306094
2-[2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 46306094) has the molecular formula C21H23ClN6O2S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is 2-[2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 46306094 |
| Molecular Formula | C21H23ClN6O2S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-[2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C(=O)Nc1sc2c(c1C(N)=O)CCCC2)n1c(N)nnc1SCc1ccccc1Cl |
| InChI | InChI=1S/C21H23ClN6O2S2/c1-11(18(30)25-19-16(17(23)29)13-7-3-5-9-15(13)32-19)28-20(24)26-27-21(28)31-10-12-6-2-4-8-14(12)22/h2,4,6,8,11H,3,5,7,9-10H2,1H3,(H2,23,29)(H2,24,26)(H,25,30) |
| InChIKey | WWOWIUJZNBDFRD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |