C22H23ClN6OS2 — CID 46306108
2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide (PubChem CID 46306108) has the molecular formula C22H23ClN6OS2 and a molecular weight of 487.05 g/mol. Its IUPAC name is 2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide.
| Compound Name | 2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide |
|---|---|
| PubChem CID | 46306108 |
| Molecular Formula | C22H23ClN6OS2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 2-[3-amino-5-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide |
| SMILES | CCC(C(=O)Nc1sc2c(c1C#N)CCCC2)n1c(N)nnc1SCc1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN6OS2/c1-2-17(19(30)26-20-15(11-24)14-8-4-6-10-18(14)32-20)29-21(25)27-28-22(29)31-12-13-7-3-5-9-16(13)23/h3,5,7,9,17H,2,4,6,8,10,12H2,1H3,(H2,25,27)(H,26,30) |
| InChIKey | FMPMFCRXJHHASR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |