C18H24N6O4S2 — CID 46306587
ethyl 2-[[5-amino-4-[1-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 46306587) has the molecular formula C18H24N6O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is ethyl 2-[[5-amino-4-[1-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-amino-4-[1-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 46306587 |
| Molecular Formula | C18H24N6O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | ethyl 2-[[5-amino-4-[1-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(N)n1C(C)C(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C18H24N6O4S2/c1-3-28-12(25)8-29-18-23-22-17(20)24(18)9(2)15(27)21-16-13(14(19)26)10-6-4-5-7-11(10)30-16/h9H,3-8H2,1-2H3,(H2,19,26)(H2,20,22)(H,21,27) |
| InChIKey | YPRFRGWJBXNJHW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 155.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |