C21H26N4O4 — CID 4630845
9'-hexyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile (PubChem CID 4630845) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 9'-hexyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile.
| Compound Name | 9'-hexyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile |
|---|---|
| PubChem CID | 4630845 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 9'-hexyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCC4(CC2C1(C#N)C(C#N)(C#N)C(CCCCCC)O3)OCCO4 |
| InChI | InChI=1S/C21H26N4O4/c1-2-3-4-5-6-16-18(12-22,13-23)20(14-24)15-11-19(26-9-10-27-19)7-8-21(15,28-16)29-17(20)25/h15-16,25H,2-11H2,1H3/b25-17+ |
| InChIKey | WRIDMPUYBZJARJ-KOEQRZSOSA-N |
| XLogP | 3.15 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|