C25H34N4O4 — CID 4630849
9'-decyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile (PubChem CID 4630849) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 9'-decyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile.
| Compound Name | 9'-decyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile |
|---|---|
| PubChem CID | 4630849 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 9'-decyl-12'-iminospiro[1,3-dioxolane-2,4'-10,11-dioxatricyclo[5.3.2.01,6]dodecane]-7',8',8'-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCC4(CC2C1(C#N)C(C#N)(C#N)C(CCCCCCCCCC)O3)OCCO4 |
| InChI | InChI=1S/C25H34N4O4/c1-2-3-4-5-6-7-8-9-10-20-22(16-26,17-27)24(18-28)19-15-23(30-13-14-31-23)11-12-25(19,32-20)33-21(24)29/h19-20,29H,2-15H2,1H3/b29-21+ |
| InChIKey | QLZGJSFQYLATRJ-XHLNEMQHSA-N |
| XLogP | 4.71 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|