C17H10F2IN — CID 46313594
2,6-bis(4-fluorophenyl)-3-iodopyridine (PubChem CID 46313594) has the molecular formula C17H10F2IN and a molecular weight of 393.17 g/mol. Its IUPAC name is 2,6-bis(4-fluorophenyl)-3-iodopyridine.
| Compound Name | 2,6-bis(4-fluorophenyl)-3-iodopyridine |
|---|---|
| PubChem CID | 46313594 |
| Molecular Formula | C17H10F2IN |
| Molecular Weight | 393.17 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2,6-bis(4-fluorophenyl)-3-iodopyridine |
| SMILES | Fc1ccc(-c2ccc(I)c(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H10F2IN/c18-13-5-1-11(2-6-13)16-10-9-15(20)17(21-16)12-3-7-14(19)8-4-12/h1-10H |
| InChIKey | OVKYMRFLPXQOOV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.17 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|