C17H15BrN2O — CID 4631756
2-(4-bromophenyl)-1-(5,6-dimethylbenzimidazol-1-yl)ethanone (PubChem CID 4631756) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(5,6-dimethylbenzimidazol-1-yl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(5,6-dimethylbenzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 4631756 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(4-bromophenyl)-1-(5,6-dimethylbenzimidazol-1-yl)ethanone |
| SMILES | Cc1cc2ncn(C(=O)Cc3ccc(Br)cc3)c2cc1C |
| InChI | InChI=1S/C17H15BrN2O/c1-11-7-15-16(8-12(11)2)20(10-19-15)17(21)9-13-3-5-14(18)6-4-13/h3-8,10H,9H2,1-2H3 |
| InChIKey | XFDHIOUCIZKEBI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |