C20H16N4O3S — CID 46322318
(4-methylphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate (PubChem CID 46322318) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is (4-methylphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate.
| Compound Name | (4-methylphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 46322318 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (4-methylphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate |
| SMILES | Cc1ccc(OC(=O)CSc2nc(-c3ccccc3)nc3cc(=O)[nH]n23)cc1 |
| InChI | InChI=1S/C20H16N4O3S/c1-13-7-9-15(10-8-13)27-18(26)12-28-20-22-19(14-5-3-2-4-6-14)21-16-11-17(25)23-24(16)20/h2-11H,12H2,1H3,(H,23,25) |
| InChIKey | OINFISYRZZKGBF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|