C20H16N4O4S — CID 46322324
(4-methoxyphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate (PubChem CID 46322324) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate.
| Compound Name | (4-methoxyphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 46322324 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (4-methoxyphenyl) 2-[(7-oxo-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl)sulfanyl]acetate |
| SMILES | COc1ccc(OC(=O)CSc2nc(-c3ccccc3)nc3cc(=O)[nH]n23)cc1 |
| InChI | InChI=1S/C20H16N4O4S/c1-27-14-7-9-15(10-8-14)28-18(26)12-29-20-22-19(13-5-3-2-4-6-13)21-16-11-17(25)23-24(16)20/h2-11H,12H2,1H3,(H,23,25) |
| InChIKey | JSKCFJUBUHGCRJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|