C21H20N4O2S — CID 20942185
4-[2-(4-ethylphenoxy)ethylsulfanyl]-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one (PubChem CID 20942185) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[2-(4-ethylphenoxy)ethylsulfanyl]-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one.
| Compound Name | 4-[2-(4-ethylphenoxy)ethylsulfanyl]-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 20942185 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-[2-(4-ethylphenoxy)ethylsulfanyl]-2-phenyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
| SMILES | CCc1ccc(OCCSc2nc(-c3ccccc3)nc3cc(=O)[nH]n23)cc1 |
| InChI | InChI=1S/C21H20N4O2S/c1-2-15-8-10-17(11-9-15)27-12-13-28-21-23-20(16-6-4-3-5-7-16)22-18-14-19(26)24-25(18)21/h3-11,14H,2,12-13H2,1H3,(H,24,26) |
| InChIKey | XRFNXOBSRSPETL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|