C24H26N4O2S — CID 140876442
2-(4-tert-butylphenyl)-4-[(4-ethylphenoxy)methylsulfanyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one (PubChem CID 140876442) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-[(4-ethylphenoxy)methylsulfanyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one.
| Compound Name | 2-(4-tert-butylphenyl)-4-[(4-ethylphenoxy)methylsulfanyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 140876442 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-[(4-ethylphenoxy)methylsulfanyl]-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
| SMILES | CCc1ccc(OCSc2nc(-c3ccc(C(C)(C)C)cc3)nc3cc(=O)[nH]n23)cc1 |
| InChI | InChI=1S/C24H26N4O2S/c1-5-16-6-12-19(13-7-16)30-15-31-23-26-22(25-20-14-21(29)27-28(20)23)17-8-10-18(11-9-17)24(2,3)4/h6-14H,5,15H2,1-4H3,(H,27,29) |
| InChIKey | MVIZGNWSZUNQBA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|