C20H26N4O — CID 157442552
2-(4-tert-butylphenyl)-4-pentyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one (PubChem CID 157442552) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-pentyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one.
| Compound Name | 2-(4-tert-butylphenyl)-4-pentyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 157442552 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-pentyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
| SMILES | CCCCCc1nc(-c2ccc(C(C)(C)C)cc2)nc2cc(=O)[nH]n12 |
| InChI | InChI=1S/C20H26N4O/c1-5-6-7-8-16-21-19(22-17-13-18(25)23-24(16)17)14-9-11-15(12-10-14)20(2,3)4/h9-13H,5-8H2,1-4H3,(H,23,25) |
| InChIKey | YEICKLNFQIGEAK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|