C25H22N4O5S — CID 46326065
ethyl 2-[(2-benzamido-4-methoxy-1,3-benzothiazol-6-yl)carbamoylamino]benzoate (PubChem CID 46326065) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is ethyl 2-[(2-benzamido-4-methoxy-1,3-benzothiazol-6-yl)carbamoylamino]benzoate.
| Compound Name | ethyl 2-[(2-benzamido-4-methoxy-1,3-benzothiazol-6-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46326065 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | ethyl 2-[(2-benzamido-4-methoxy-1,3-benzothiazol-6-yl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Nc1cc(OC)c2nc(NC(=O)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C25H22N4O5S/c1-3-34-23(31)17-11-7-8-12-18(17)27-24(32)26-16-13-19(33-2)21-20(14-16)35-25(28-21)29-22(30)15-9-5-4-6-10-15/h4-14H,3H2,1-2H3,(H2,26,27,32)(H,28,29,30) |
| InChIKey | OKGQMUOYUMROED-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |