C24H32N4O5S — CID 46333530
3-[(4-ethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)-4-piperazin-1-ylbenzamide (PubChem CID 46333530) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)-4-piperazin-1-ylbenzamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333530 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)-4-piperazin-1-ylbenzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(C(=O)NCC3CCCO3)ccc2N2CCNCC2)cc1 |
| InChI | InChI=1S/C24H32N4O5S/c1-2-32-19-6-8-21(9-7-19)34(30,31)27-22-16-18(24(29)26-17-20-4-3-15-33-20)5-10-23(22)28-13-11-25-12-14-28/h5-10,16,20,25,27H,2-4,11-15,17H2,1H3,(H,26,29) |
| InChIKey | MDDQUHPDNACPRP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |