C17H19N5O3S2 — CID 46336575
N-[5-[(2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide (PubChem CID 46336575) has the molecular formula C17H19N5O3S2 and a molecular weight of 405.51 g/mol. Its IUPAC name is N-[5-[(2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[5-[(2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 46336575 |
| Molecular Formula | C17H19N5O3S2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[5-[(2-methyl-7-oxo-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclohexanecarboxamide |
| SMILES | Cc1cc2nc(CSc3nnc(NC(=O)C4CCCCC4)s3)cc(=O)n2o1 |
| InChI | InChI=1S/C17H19N5O3S2/c1-10-7-13-18-12(8-14(23)22(13)25-10)9-26-17-21-20-16(27-17)19-15(24)11-5-3-2-4-6-11/h7-8,11H,2-6,9H2,1H3,(H,19,20,24) |
| InChIKey | BKGHJAJVJSGBOX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|