C19H15ClN4OS — CID 46336653
N-[(3-chlorophenyl)methyl]-2-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)acetamide (PubChem CID 46336653) has the molecular formula C19H15ClN4OS and a molecular weight of 382.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)acetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 46336653 |
| Molecular Formula | C19H15ClN4OS |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nc2ncccc2n2cccc12)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H15ClN4OS/c20-14-5-1-4-13(10-14)11-22-17(25)12-26-19-16-7-3-9-24(16)15-6-2-8-21-18(15)23-19/h1-10H,11-12H2,(H,22,25) |
| InChIKey | IUXPLDURGNDBMQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |