C15H13N7O3S2 — CID 46337817
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide (PubChem CID 46337817) has the molecular formula C15H13N7O3S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 46337817 |
| Molecular Formula | C15H13N7O3S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide |
| SMILES | CCc1nnc(NC(=O)CSc2nc(-c3ccco3)nc3cc(=O)[nH]n23)s1 |
| InChI | InChI=1S/C15H13N7O3S2/c1-2-12-19-20-14(27-12)17-11(24)7-26-15-18-13(8-4-3-5-25-8)16-9-6-10(23)21-22(9)15/h3-6H,2,7H2,1H3,(H,21,23)(H,17,20,24) |
| InChIKey | CPEVIYNGPXQESW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|