C29H32N4O2 — CID 46338950
4-benzyl-1-(3-ethylphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-4H-imidazol-5-one (PubChem CID 46338950) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-benzyl-1-(3-ethylphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-4H-imidazol-5-one.
| Compound Name | 4-benzyl-1-(3-ethylphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-4H-imidazol-5-one |
|---|---|
| PubChem CID | 46338950 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 4-benzyl-1-(3-ethylphenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-4H-imidazol-5-one |
| SMILES | CCc1cccc(N2C(=O)C(Cc3ccccc3)N=C2N2CCN(c3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C29H32N4O2/c1-3-22-12-9-13-24(20-22)33-28(34)25(21-23-10-5-4-6-11-23)30-29(33)32-18-16-31(17-19-32)26-14-7-8-15-27(26)35-2/h4-15,20,25H,3,16-19,21H2,1-2H3 |
| InChIKey | IVLFLXSIHSYIGH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |