C25H29N3O4 — CID 46338970
ethyl 1-[4-benzyl-1-(2-methoxyphenyl)-5-oxo-4H-imidazol-2-yl]piperidine-4-carboxylate (PubChem CID 46338970) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl 1-[4-benzyl-1-(2-methoxyphenyl)-5-oxo-4H-imidazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-benzyl-1-(2-methoxyphenyl)-5-oxo-4H-imidazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46338970 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | ethyl 1-[4-benzyl-1-(2-methoxyphenyl)-5-oxo-4H-imidazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(Cc3ccccc3)C(=O)N2c2ccccc2OC)CC1 |
| InChI | InChI=1S/C25H29N3O4/c1-3-32-24(30)19-13-15-27(16-14-19)25-26-20(17-18-9-5-4-6-10-18)23(29)28(25)21-11-7-8-12-22(21)31-2/h4-12,19-20H,3,13-17H2,1-2H3 |
| InChIKey | PPBNCNZRXWTPMF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |