C25H26N4O3 — CID 46348996
N-[2-[furan-2-ylmethyl(2-methoxyethyl)amino]ethyl]-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 46348996) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(2-methoxyethyl)amino]ethyl]-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-[2-[furan-2-ylmethyl(2-methoxyethyl)amino]ethyl]-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46348996 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(2-methoxyethyl)amino]ethyl]-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | COCCN(CCNC(=O)c1cc(-c2ccccn2)nc2ccccc12)Cc1ccco1 |
| InChI | InChI=1S/C25H26N4O3/c1-31-16-14-29(18-19-7-6-15-32-19)13-12-27-25(30)21-17-24(23-10-4-5-11-26-23)28-22-9-3-2-8-20(21)22/h2-11,15,17H,12-14,16,18H2,1H3,(H,27,30) |
| InChIKey | CPKYYQQQUCIACP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |