C21H25N5O2 — CID 155555807
N-[2-(diethylamino)ethyl]-2-(2-methoxypyrimidin-5-yl)quinoline-4-carboxamide (PubChem CID 155555807) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(2-methoxypyrimidin-5-yl)quinoline-4-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(2-methoxypyrimidin-5-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 155555807 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(2-methoxypyrimidin-5-yl)quinoline-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(-c2cnc(OC)nc2)nc2ccccc12 |
| InChI | InChI=1S/C21H25N5O2/c1-4-26(5-2)11-10-22-20(27)17-12-19(15-13-23-21(28-3)24-14-15)25-18-9-7-6-8-16(17)18/h6-9,12-14H,4-5,10-11H2,1-3H3,(H,22,27) |
| InChIKey | ZOPINTJKXOYOHF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |