C24H27FN4O2 — CID 46349627
ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidin-4-yl]methylamino]quinazoline-2-carboxylate (PubChem CID 46349627) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidin-4-yl]methylamino]quinazoline-2-carboxylate.
| Compound Name | ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidin-4-yl]methylamino]quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 46349627 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidin-4-yl]methylamino]quinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1nc(NCC2CCN(Cc3cccc(F)c3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C24H27FN4O2/c1-2-31-24(30)23-27-21-9-4-3-8-20(21)22(28-23)26-15-17-10-12-29(13-11-17)16-18-6-5-7-19(25)14-18/h3-9,14,17H,2,10-13,15-16H2,1H3,(H,26,27,28) |
| InChIKey | ZATAQNKKHOXVQV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |