C19H24N4 — CID 4634985
2-amino-4-[4-(dimethylamino)phenyl]-5-ethyl-6-propylpyridine-3-carbonitrile (PubChem CID 4634985) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-amino-4-[4-(dimethylamino)phenyl]-5-ethyl-6-propylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[4-(dimethylamino)phenyl]-5-ethyl-6-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4634985 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-amino-4-[4-(dimethylamino)phenyl]-5-ethyl-6-propylpyridine-3-carbonitrile |
| SMILES | CCCc1nc(N)c(C#N)c(-c2ccc(N(C)C)cc2)c1CC |
| InChI | InChI=1S/C19H24N4/c1-5-7-17-15(6-2)18(16(12-20)19(21)22-17)13-8-10-14(11-9-13)23(3)4/h8-11H,5-7H2,1-4H3,(H2,21,22) |
| InChIKey | LBOOOIASOWHWDN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |