C23H20N2O5 — CID 46354151
3-phenyl-N-(3,4,5-trimethoxyphenyl)-2,1-benzoxazole-6-carboxamide (PubChem CID 46354151) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 3-phenyl-N-(3,4,5-trimethoxyphenyl)-2,1-benzoxazole-6-carboxamide.
| Compound Name | 3-phenyl-N-(3,4,5-trimethoxyphenyl)-2,1-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 46354151 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-phenyl-N-(3,4,5-trimethoxyphenyl)-2,1-benzoxazole-6-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3c(-c4ccccc4)onc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O5/c1-27-19-12-16(13-20(28-2)22(19)29-3)24-23(26)15-9-10-17-18(11-15)25-30-21(17)14-7-5-4-6-8-14/h4-13H,1-3H3,(H,24,26) |
| InChIKey | OKWYSCQCEQZQBG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |