C31H39N3O3 — CID 46356879
1-acetyl-N-benzyl-4-[2-(cyclohexen-1-yl)ethyl-(4-methylbenzoyl)amino]piperidine-4-carboxamide (PubChem CID 46356879) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is 1-acetyl-N-benzyl-4-[2-(cyclohexen-1-yl)ethyl-(4-methylbenzoyl)amino]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-benzyl-4-[2-(cyclohexen-1-yl)ethyl-(4-methylbenzoyl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46356879 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | 1-acetyl-N-benzyl-4-[2-(cyclohexen-1-yl)ethyl-(4-methylbenzoyl)amino]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCc2ccccc2)(N(CCC2=CCCCC2)C(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C31H39N3O3/c1-24-13-15-28(16-14-24)29(36)34(20-17-26-9-5-3-6-10-26)31(18-21-33(22-19-31)25(2)35)30(37)32-23-27-11-7-4-8-12-27/h4,7-9,11-16H,3,5-6,10,17-23H2,1-2H3,(H,32,37) |
| InChIKey | ZKKUDTSTTKDDCM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|