C21H15ClN2O3S — CID 46358457
(4-acetylphenyl) 3-(4-chlorophenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 46358457) has the molecular formula C21H15ClN2O3S and a molecular weight of 410.88 g/mol. Its IUPAC name is (4-acetylphenyl) 3-(4-chlorophenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | (4-acetylphenyl) 3-(4-chlorophenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 46358457 |
| Molecular Formula | C21H15ClN2O3S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (4-acetylphenyl) 3-(4-chlorophenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)c2cc3c(-c4ccc(Cl)cc4)nn(C)c3s2)cc1 |
| InChI | InChI=1S/C21H15ClN2O3S/c1-12(25)13-5-9-16(10-6-13)27-21(26)18-11-17-19(23-24(2)20(17)28-18)14-3-7-15(22)8-4-14/h3-11H,1-2H3 |
| InChIKey | VNARIWCWTSTGEW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|