C17H22N2O2S — CID 4635854
N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 4635854) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4635854 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NC(=S)NCCC2=CCCCC2)o1 |
| InChI | InChI=1S/C17H22N2O2S/c1-13-7-8-15(21-13)9-10-16(20)19-17(22)18-12-11-14-5-3-2-4-6-14/h5,7-10H,2-4,6,11-12H2,1H3,(H2,18,19,20,22) |
| InChIKey | SQHVUITVACUGIA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|