C23H23N3O6S — CID 46361550
methyl 4-[[2-(2-oxo-6-pyrrolidin-1-ylsulfonylquinolin-1-yl)acetyl]amino]benzoate (PubChem CID 46361550) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is methyl 4-[[2-(2-oxo-6-pyrrolidin-1-ylsulfonylquinolin-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2-oxo-6-pyrrolidin-1-ylsulfonylquinolin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 46361550 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl 4-[[2-(2-oxo-6-pyrrolidin-1-ylsulfonylquinolin-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cn2c(=O)ccc3cc(S(=O)(=O)N4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C23H23N3O6S/c1-32-23(29)16-4-7-18(8-5-16)24-21(27)15-26-20-10-9-19(14-17(20)6-11-22(26)28)33(30,31)25-12-2-3-13-25/h4-11,14H,2-3,12-13,15H2,1H3,(H,24,27) |
| InChIKey | CACWIXZOTIPBJI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |