C22H18IN3O3S — CID 4636463
N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]-4-phenylbenzamide (PubChem CID 4636463) has the molecular formula C22H18IN3O3S and a molecular weight of 531.38 g/mol. Its IUPAC name is N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 4636463 |
| Molecular Formula | C22H18IN3O3S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | N-[[(3-iodo-4-methoxybenzoyl)amino]carbamothioyl]-4-phenylbenzamide |
| SMILES | COc1ccc(C(=O)NNC(=S)NC(=O)c2ccc(-c3ccccc3)cc2)cc1I |
| InChI | InChI=1S/C22H18IN3O3S/c1-29-19-12-11-17(13-18(19)23)21(28)25-26-22(30)24-20(27)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-13H,1H3,(H,25,28)(H2,24,26,27,30) |
| InChIKey | OGLXVKDTYZJZJJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|