C26H28N4O2 — CID 46364772
6-(2-methoxyphenyl)-3-(4-methylphenyl)-N-pentyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 46364772) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-3-(4-methylphenyl)-N-pentyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(2-methoxyphenyl)-3-(4-methylphenyl)-N-pentyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46364772 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 6-(2-methoxyphenyl)-3-(4-methylphenyl)-N-pentyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2ccccc2OC)nc2n[nH]c(-c3ccc(C)cc3)c12 |
| InChI | InChI=1S/C26H28N4O2/c1-4-5-8-15-27-26(31)20-16-21(19-9-6-7-10-22(19)32-3)28-25-23(20)24(29-30-25)18-13-11-17(2)12-14-18/h6-7,9-14,16H,4-5,8,15H2,1-3H3,(H,27,31)(H,28,29,30) |
| InChIKey | RRHZMWQKJKUOHY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|