C25H25FN4O3 — CID 46364827
N-butyl-6-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 46364827) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is N-butyl-6-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-butyl-6-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46364827 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-butyl-6-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2ccc(OC)c(OC)c2)nc2n[nH]c(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C25H25FN4O3/c1-4-5-12-27-25(31)18-14-19(16-8-11-20(32-2)21(13-16)33-3)28-24-22(18)23(29-30-24)15-6-9-17(26)10-7-15/h6-11,13-14H,4-5,12H2,1-3H3,(H,27,31)(H,28,29,30) |
| InChIKey | XNVHPKHGDKPANN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|