C26H27BrN4O4 — CID 46364889
3-(4-bromophenyl)-N-butyl-6-(2,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 46364889) has the molecular formula C26H27BrN4O4 and a molecular weight of 539.43 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-butyl-6-(2,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-butyl-6-(2,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46364889 |
| Molecular Formula | C26H27BrN4O4 |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 3-(4-bromophenyl)-N-butyl-6-(2,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(-c2cc(OC)c(OC)cc2OC)nc2n[nH]c(-c3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C26H27BrN4O4/c1-5-6-11-28-26(32)18-12-19(17-13-21(34-3)22(35-4)14-20(17)33-2)29-25-23(18)24(30-31-25)15-7-9-16(27)10-8-15/h7-10,12-14H,5-6,11H2,1-4H3,(H,28,32)(H,29,30,31) |
| InChIKey | WBZYEYPLCNJJOD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|