C19H18F2N4O — CID 46365158
3-(diethylamino)-N-(3,4-difluorophenyl)quinoxaline-2-carboxamide (PubChem CID 46365158) has the molecular formula C19H18F2N4O and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-(diethylamino)-N-(3,4-difluorophenyl)quinoxaline-2-carboxamide.
| Compound Name | 3-(diethylamino)-N-(3,4-difluorophenyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 46365158 |
| Molecular Formula | C19H18F2N4O |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-(diethylamino)-N-(3,4-difluorophenyl)quinoxaline-2-carboxamide |
| SMILES | CCN(CC)c1nc2ccccc2nc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H18F2N4O/c1-3-25(4-2)18-17(23-15-7-5-6-8-16(15)24-18)19(26)22-12-9-10-13(20)14(21)11-12/h5-11H,3-4H2,1-2H3,(H,22,26) |
| InChIKey | JVOMUGWCCMXMCV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |