C25H29N3O3S2 — CID 46367145
N-(2-ethylphenyl)-2-(4-methyl-6-pyrrolidin-1-ylsulfonylquinolin-2-yl)sulfanylpropanamide (PubChem CID 46367145) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-(4-methyl-6-pyrrolidin-1-ylsulfonylquinolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2-ethylphenyl)-2-(4-methyl-6-pyrrolidin-1-ylsulfonylquinolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 46367145 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-(2-ethylphenyl)-2-(4-methyl-6-pyrrolidin-1-ylsulfonylquinolin-2-yl)sulfanylpropanamide |
| SMILES | CCc1ccccc1NC(=O)C(C)Sc1cc(C)c2cc(S(=O)(=O)N3CCCC3)ccc2n1 |
| InChI | InChI=1S/C25H29N3O3S2/c1-4-19-9-5-6-10-22(19)27-25(29)18(3)32-24-15-17(2)21-16-20(11-12-23(21)26-24)33(30,31)28-13-7-8-14-28/h5-6,9-12,15-16,18H,4,7-8,13-14H2,1-3H3,(H,27,29) |
| InChIKey | XNUGMKDQTWIZEE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |